C17H25BrClN3O — CID 119931058
(4-bromophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119931058) has the molecular formula C17H25BrClN3O and a molecular weight of 402.76 g/mol. Its IUPAC name is (4-bromophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | (4-bromophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119931058 |
| Molecular Formula | C17H25BrClN3O |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (4-bromophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Br)cc1)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C17H24BrN3O.ClH/c18-16-3-1-15(2-4-16)17(22)21-11-9-20(10-12-21)13-14-5-7-19-8-6-14;/h1-4,14,19H,5-13H2;1H |
| InChIKey | QZOFSRVNCUIWMO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |