C18H27BrN4O — CID 120853962
N-(4-bromophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetamide (PubChem CID 120853962) has the molecular formula C18H27BrN4O and a molecular weight of 395.35 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 120853962 |
| Molecular Formula | C18H27BrN4O |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CC2CCNCC2)CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H27BrN4O/c19-16-1-3-17(4-2-16)21-18(24)14-23-11-9-22(10-12-23)13-15-5-7-20-8-6-15/h1-4,15,20H,5-14H2,(H,21,24) |
| InChIKey | RVSCIXOCZCEKGW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |