C16H36Cl4N4 — CID 18770386
1,4-bis(piperidin-4-ylmethyl)piperazine;tetrahydrochloride (PubChem CID 18770386) has the molecular formula C16H36Cl4N4 and a molecular weight of 426.30 g/mol. Its IUPAC name is 1,4-bis(piperidin-4-ylmethyl)piperazine;tetrahydrochloride.
| Compound Name | 1,4-bis(piperidin-4-ylmethyl)piperazine;tetrahydrochloride |
|---|---|
| PubChem CID | 18770386 |
| Molecular Formula | C16H36Cl4N4 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1,4-bis(piperidin-4-ylmethyl)piperazine;tetrahydrochloride |
| SMILES | C1CC(CN2CCN(CC3CCNCC3)CC2)CCN1.Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C16H32N4.4ClH/c1-5-17-6-2-15(1)13-19-9-11-20(12-10-19)14-16-3-7-18-8-4-16;;;;/h15-18H,1-14H2;4*1H |
| InChIKey | GMMURQJRDFFQDW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |