C16H32N4 — CID 18770387
1,4-bis(piperidin-4-ylmethyl)piperazine (PubChem CID 18770387) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1,4-bis(piperidin-4-ylmethyl)piperazine.
| Compound Name | 1,4-bis(piperidin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 18770387 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 1,4-bis(piperidin-4-ylmethyl)piperazine |
| SMILES | C1CC(CN2CCN(CC3CCNCC3)CC2)CCN1 |
| InChI | InChI=1S/C16H32N4/c1-5-17-6-2-15(1)13-19-9-11-20(12-10-19)14-16-3-7-18-8-4-16/h15-18H,1-14H2 |
| InChIKey | CXPVURPCWVRDAG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |