C10H22N4O2S — CID 119929956
4-(piperidin-4-ylmethyl)piperazine-1-sulfonamide (PubChem CID 119929956) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is 4-(piperidin-4-ylmethyl)piperazine-1-sulfonamide.
| Compound Name | 4-(piperidin-4-ylmethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 119929956 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-(piperidin-4-ylmethyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C10H22N4O2S/c11-17(15,16)14-7-5-13(6-8-14)9-10-1-3-12-4-2-10/h10,12H,1-9H2,(H2,11,15,16) |
| InChIKey | ZGGFZPMTVWQUCQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |