C18H19N — CID 4021995
2-(3-phenylprop-2-enyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 4021995) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-(3-phenylprop-2-enyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-phenylprop-2-enyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 4021995 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(3-phenylprop-2-enyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | C(=Cc1ccccc1)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H19N/c1-2-7-16(8-3-1)9-6-13-19-14-12-17-10-4-5-11-18(17)15-19/h1-11H,12-15H2 |
| InChIKey | NGTBVPMVXAYHJZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |