C21H23NO3 — CID 74224118
[4-[(Z)-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 74224118) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is [4-[(Z)-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 74224118 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [4-[(Z)-3-(3,4-dihydro-1H-isoquinolin-2-yl)prop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C\CN2CCc3ccccc3C2)ccc1OC(C)=O |
| InChI | InChI=1S/C21H23NO3/c1-16(23)25-20-10-9-17(14-21(20)24-2)6-5-12-22-13-11-18-7-3-4-8-19(18)15-22/h3-10,14H,11-13,15H2,1-2H3/b6-5- |
| InChIKey | AMKBOLPDBDISTJ-WAYWQWQTSA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|