C29H30F2N2O3 — CID 74228003
[4-[(Z)-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]prop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 74228003) has the molecular formula C29H30F2N2O3 and a molecular weight of 492.57 g/mol. Its IUPAC name is [4-[(Z)-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]prop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]prop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 74228003 |
| Molecular Formula | C29H30F2N2O3 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [4-[(Z)-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]prop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C\CN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)ccc1OC(C)=O |
| InChI | InChI=1S/C29H30F2N2O3/c1-21(34)36-27-14-5-22(20-28(27)35-2)4-3-15-32-16-18-33(19-17-32)29(23-6-10-25(30)11-7-23)24-8-12-26(31)13-9-24/h3-14,20,29H,15-19H2,1-2H3/b4-3- |
| InChIKey | NWYFGDVZZGNFPS-ARJAWSKDSA-N |
| XLogP | 5.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|