C30H32F2N2O6 — CID 70055349
1-[bis(4-fluorophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine;but-2-enedioic acid (PubChem CID 70055349) has the molecular formula C30H32F2N2O6 and a molecular weight of 554.59 g/mol. Its IUPAC name is 1-[bis(4-fluorophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine;but-2-enedioic acid.
| Compound Name | 1-[bis(4-fluorophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine;but-2-enedioic acid |
|---|---|
| PubChem CID | 70055349 |
| Molecular Formula | C30H32F2N2O6 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 1-[bis(4-fluorophenyl)methyl]-4-[(2,4-dimethoxyphenyl)methyl]piperazine;but-2-enedioic acid |
| SMILES | COc1ccc(CN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c(OC)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H28F2N2O2.C4H4O4/c1-31-24-12-7-21(25(17-24)32-2)18-29-13-15-30(16-14-29)26(19-3-8-22(27)9-4-19)20-5-10-23(28)11-6-20;5-3(6)1-2-4(7)8/h3-12,17,26H,13-16,18H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FDVMZINEDYYELJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|