C32H34N2O6-2 — CID 53428072
1-benzhydryl-4-[3-(2,4-dimethoxyphenyl)prop-2-enyl]piperazine;but-2-enedioate (PubChem CID 53428072) has the molecular formula C32H34N2O6-2 and a molecular weight of 542.63 g/mol. Its IUPAC name is 1-benzhydryl-4-[3-(2,4-dimethoxyphenyl)prop-2-enyl]piperazine;but-2-enedioate.
| Compound Name | 1-benzhydryl-4-[3-(2,4-dimethoxyphenyl)prop-2-enyl]piperazine;but-2-enedioate |
|---|---|
| PubChem CID | 53428072 |
| Molecular Formula | C32H34N2O6-2 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 1-benzhydryl-4-[3-(2,4-dimethoxyphenyl)prop-2-enyl]piperazine;but-2-enedioate |
| SMILES | COc1ccc(C=CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(OC)c1.O=C([O-])C=CC(=O)[O-] |
| InChI | InChI=1S/C28H32N2O2.C4H4O4/c1-31-26-16-15-23(27(22-26)32-2)14-9-17-29-18-20-30(21-19-29)28(24-10-5-3-6-11-24)25-12-7-4-8-13-25;5-3(6)1-2-4(7)8/h3-16,22,28H,17-21H2,1-2H3;1-2H,(H,5,6)(H,7,8)/p-2 |
| InChIKey | YQSOIGHEUYMEFI-UHFFFAOYSA-L |
| XLogP | 2.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|