C31H36N2O3 — CID 54084270
1-benzhydryl-4-[5-(2,3,4-trimethoxyphenyl)penta-2,4-dienyl]piperazine (PubChem CID 54084270) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 1-benzhydryl-4-[5-(2,3,4-trimethoxyphenyl)penta-2,4-dienyl]piperazine.
| Compound Name | 1-benzhydryl-4-[5-(2,3,4-trimethoxyphenyl)penta-2,4-dienyl]piperazine |
|---|---|
| PubChem CID | 54084270 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 1-benzhydryl-4-[5-(2,3,4-trimethoxyphenyl)penta-2,4-dienyl]piperazine |
| SMILES | COc1ccc(C=CC=CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C31H36N2O3/c1-34-28-19-18-27(30(35-2)31(28)36-3)17-11-6-12-20-32-21-23-33(24-22-32)29(25-13-7-4-8-14-25)26-15-9-5-10-16-26/h4-19,29H,20-24H2,1-3H3 |
| InChIKey | MPHMQPQJAMCNRQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|