C30H34N2O3 — CID 21280912
4-[(1E,3E)-5-(4-benzhydrylpiperazin-1-yl)penta-1,3-dienyl]-2,6-dimethoxyphenol (PubChem CID 21280912) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-[(1E,3E)-5-(4-benzhydrylpiperazin-1-yl)penta-1,3-dienyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1E,3E)-5-(4-benzhydrylpiperazin-1-yl)penta-1,3-dienyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 21280912 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 4-[(1E,3E)-5-(4-benzhydrylpiperazin-1-yl)penta-1,3-dienyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(/C=C/C=C/CN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc(OC)c1O |
| InChI | InChI=1S/C30H34N2O3/c1-34-27-22-24(23-28(35-2)30(27)33)12-6-5-11-17-31-18-20-32(21-19-31)29(25-13-7-3-8-14-25)26-15-9-4-10-16-26/h3-16,22-23,29,33H,17-21H2,1-2H3/b11-5+,12-6+ |
| InChIKey | KCMHWIGUMVBSGM-YDWXAUTNSA-N |
| XLogP | 5.39 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|