C33H38N2O5 — CID 139715611
5-[4-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethoxy]-3-methoxyphenyl]penta-2,4-dienoic acid (PubChem CID 139715611) has the molecular formula C33H38N2O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is 5-[4-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethoxy]-3-methoxyphenyl]penta-2,4-dienoic acid.
| Compound Name | 5-[4-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethoxy]-3-methoxyphenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 139715611 |
| Molecular Formula | C33H38N2O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 5-[4-[2-[2-(4-benzhydrylpiperazin-1-yl)ethoxy]ethoxy]-3-methoxyphenyl]penta-2,4-dienoic acid |
| SMILES | COc1cc(C=CC=CC(=O)O)ccc1OCCOCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H38N2O5/c1-38-31-26-27(10-8-9-15-32(36)37)16-17-30(31)40-25-24-39-23-22-34-18-20-35(21-19-34)33(28-11-4-2-5-12-28)29-13-6-3-7-14-29/h2-17,26,33H,18-25H2,1H3,(H,36,37) |
| InChIKey | DWYCOHWMBMGDQN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|