C34H35NO5 — CID 139715560
5-[4-[4-(4-benzhydryloxypiperidin-1-yl)but-2-ynoxy]-3-methoxyphenyl]penta-2,4-dienoic acid (PubChem CID 139715560) has the molecular formula C34H35NO5 and a molecular weight of 537.66 g/mol. Its IUPAC name is 5-[4-[4-(4-benzhydryloxypiperidin-1-yl)but-2-ynoxy]-3-methoxyphenyl]penta-2,4-dienoic acid.
| Compound Name | 5-[4-[4-(4-benzhydryloxypiperidin-1-yl)but-2-ynoxy]-3-methoxyphenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 139715560 |
| Molecular Formula | C34H35NO5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 5-[4-[4-(4-benzhydryloxypiperidin-1-yl)but-2-ynoxy]-3-methoxyphenyl]penta-2,4-dienoic acid |
| SMILES | COc1cc(C=CC=CC(=O)O)ccc1OCC#CCN1CCC(OC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H35NO5/c1-38-32-26-27(12-8-9-17-33(36)37)18-19-31(32)39-25-11-10-22-35-23-20-30(21-24-35)40-34(28-13-4-2-5-14-28)29-15-6-3-7-16-29/h2-9,12-19,26,30,34H,20-25H2,1H3,(H,36,37) |
| InChIKey | NZIJJDWWAQAZRZ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|