C32H38N2O4 — CID 56989592
4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-(4-hydroxy-3-methoxyphenyl)hept-1-en-3-one (PubChem CID 56989592) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is 4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-(4-hydroxy-3-methoxyphenyl)hept-1-en-3-one.
| Compound Name | 4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-(4-hydroxy-3-methoxyphenyl)hept-1-en-3-one |
|---|---|
| PubChem CID | 56989592 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 4-amino-7-(4-benzhydryloxypiperidin-1-yl)-1-(4-hydroxy-3-methoxyphenyl)hept-1-en-3-one |
| SMILES | COc1cc(C=CC(=O)C(N)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)ccc1O |
| InChI | InChI=1S/C32H38N2O4/c1-37-31-23-24(15-17-30(31)36)14-16-29(35)28(33)13-8-20-34-21-18-27(19-22-34)38-32(25-9-4-2-5-10-25)26-11-6-3-7-12-26/h2-7,9-12,14-17,23,27-28,32,36H,8,13,18-22,33H2,1H3 |
| InChIKey | PXYQIRIMUAJXLO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|