C28H39NO3 — CID 139601779
methyl 6-[4-[phenyl-(4-propan-2-ylphenyl)methoxy]piperidin-1-yl]hexanoate (PubChem CID 139601779) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is methyl 6-[4-[phenyl-(4-propan-2-ylphenyl)methoxy]piperidin-1-yl]hexanoate.
| Compound Name | methyl 6-[4-[phenyl-(4-propan-2-ylphenyl)methoxy]piperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 139601779 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | methyl 6-[4-[phenyl-(4-propan-2-ylphenyl)methoxy]piperidin-1-yl]hexanoate |
| SMILES | COC(=O)CCCCCN1CCC(OC(c2ccccc2)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C28H39NO3/c1-22(2)23-13-15-25(16-14-23)28(24-10-6-4-7-11-24)32-26-17-20-29(21-18-26)19-9-5-8-12-27(30)31-3/h4,6-7,10-11,13-16,22,26,28H,5,8-9,12,17-21H2,1-3H3 |
| InChIKey | ZYHVEXOCYCKIRP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|