C30H39NO8 — CID 67903102
but-2-enedioic acid;7-[4-[(4-methoxyphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid (PubChem CID 67903102) has the molecular formula C30H39NO8 and a molecular weight of 541.64 g/mol. Its IUPAC name is but-2-enedioic acid;7-[4-[(4-methoxyphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid.
| Compound Name | but-2-enedioic acid;7-[4-[(4-methoxyphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 67903102 |
| Molecular Formula | C30H39NO8 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | but-2-enedioic acid;7-[4-[(4-methoxyphenyl)-phenylmethoxy]piperidin-1-yl]heptanoic acid |
| SMILES | COc1ccc(C(OC2CCN(CCCCCCC(=O)O)CC2)c2ccccc2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H35NO4.C4H4O4/c1-30-23-14-12-22(13-15-23)26(21-9-5-4-6-10-21)31-24-16-19-27(20-17-24)18-8-3-2-7-11-25(28)29;5-3(6)1-2-4(7)8/h4-6,9-10,12-15,24,26H,2-3,7-8,11,16-20H2,1H3,(H,28,29);1-2H,(H,5,6)(H,7,8) |
| InChIKey | YOFROOFUSNOLAM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|