C22H27Cl2NO3 — CID 67831658
4-[4-[(2-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoic acid;hydrochloride (PubChem CID 67831658) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is 4-[4-[(2-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoic acid;hydrochloride.
| Compound Name | 4-[4-[(2-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67831658 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 4-[4-[(2-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCN1CCC(OC(c2ccccc2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H26ClNO3.ClH/c23-20-10-5-4-9-19(20)22(17-7-2-1-3-8-17)27-18-12-15-24(16-13-18)14-6-11-21(25)26;/h1-5,7-10,18,22H,6,11-16H2,(H,25,26);1H |
| InChIKey | RBMZTNVJPLKRKJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |