C24H30ClNO3 — CID 54498618
ethyl 4-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoate (PubChem CID 54498618) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is ethyl 4-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 54498618 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | ethyl 4-[4-[(3-chlorophenyl)-phenylmethoxy]piperidin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCC(OC(c2ccccc2)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H30ClNO3/c1-2-28-23(27)12-7-15-26-16-13-22(14-17-26)29-24(19-8-4-3-5-9-19)20-10-6-11-21(25)18-20/h3-6,8-11,18,22,24H,2,7,12-17H2,1H3 |
| InChIKey | YAWDDNQBZHDQMJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |