C18H27NO3 — CID 110922539
ethyl 4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]butanoate (PubChem CID 110922539) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethyl 4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 110922539 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethyl 4-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCC(C(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27NO3/c1-2-22-17(20)9-6-12-19-13-10-16(11-14-19)18(21)15-7-4-3-5-8-15/h3-5,7-8,16,18,21H,2,6,9-14H2,1H3 |
| InChIKey | MYQNLKFSHULTHJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |