C23H29ClN2O2 — CID 54551430
ethyl 4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]butanoate (PubChem CID 54551430) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is ethyl 4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 54551430 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 4-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H29ClN2O2/c1-2-28-22(27)9-6-14-25-15-17-26(18-16-25)23(19-7-4-3-5-8-19)20-10-12-21(24)13-11-20/h3-5,7-8,10-13,23H,2,6,9,14-18H2,1H3 |
| InChIKey | ZKEBJIKABZTCJF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |