C33H49ClN2O6 — CID 159159754
tert-butyl 4-[2-[2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]butanoate (PubChem CID 159159754) has the molecular formula C33H49ClN2O6 and a molecular weight of 605.22 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 159159754 |
| Molecular Formula | C33H49ClN2O6 |
| Molecular Weight | 605.22 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCOCCOCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C33H49ClN2O6/c1-33(2,3)42-31(37)10-7-20-38-22-24-40-26-27-41-25-23-39-21-19-35-15-17-36(18-16-35)32(28-8-5-4-6-9-28)29-11-13-30(34)14-12-29/h4-6,8-9,11-14,32H,7,10,15-27H2,1-3H3 |
| InChIKey | KKIMUNWNJJHTTD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.22 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|