C25H37ClN2O — CID 170602345
1-[(4-chlorophenyl)-phenylmethyl]-4-[2-(2-methylpropoxy)ethyl]piperazine;ethane (PubChem CID 170602345) has the molecular formula C25H37ClN2O and a molecular weight of 417.04 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-phenylmethyl]-4-[2-(2-methylpropoxy)ethyl]piperazine;ethane.
| Compound Name | 1-[(4-chlorophenyl)-phenylmethyl]-4-[2-(2-methylpropoxy)ethyl]piperazine;ethane |
|---|---|
| PubChem CID | 170602345 |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]-4-[2-(2-methylpropoxy)ethyl]piperazine;ethane |
| SMILES | CC.CC(C)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H31ClN2O.C2H6/c1-19(2)18-27-17-16-25-12-14-26(15-13-25)23(20-6-4-3-5-7-20)21-8-10-22(24)11-9-21;1-2/h3-11,19,23H,12-18H2,1-2H3;1-2H3 |
| InChIKey | HALVFYOAXVDSBT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|