C19H23ClN2S — CID 123286407
2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanethiol (PubChem CID 123286407) has the molecular formula C19H23ClN2S and a molecular weight of 346.93 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanethiol.
| Compound Name | 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanethiol |
|---|---|
| PubChem CID | 123286407 |
| Molecular Formula | C19H23ClN2S |
| Molecular Weight | 346.93 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethanethiol |
| SMILES | SCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H23ClN2S/c20-18-8-6-17(7-9-18)19(16-4-2-1-3-5-16)22-12-10-21(11-13-22)14-15-23/h1-9,19,23H,10-15H2 |
| InChIKey | OTKPYJCAVJJVNZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|