C25H27ClN2O — CID 10250805
2-[4-[(S)-[4-(4-chlorophenyl)phenyl]-phenylmethyl]piperazin-1-yl]ethanol (PubChem CID 10250805) has the molecular formula C25H27ClN2O and a molecular weight of 406.96 g/mol. Its IUPAC name is 2-[4-[(S)-[4-(4-chlorophenyl)phenyl]-phenylmethyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(S)-[4-(4-chlorophenyl)phenyl]-phenylmethyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 10250805 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[4-[(S)-[4-(4-chlorophenyl)phenyl]-phenylmethyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN([C@@H](c2ccccc2)c2ccc(-c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H27ClN2O/c26-24-12-10-21(11-13-24)20-6-8-23(9-7-20)25(22-4-2-1-3-5-22)28-16-14-27(15-17-28)18-19-29/h1-13,25,29H,14-19H2/t25-/m0/s1 |
| InChIKey | DHUGPKGKAHOMHZ-VWLOTQADSA-N |
| XLogP | 4.71 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |