C42H54Cl2N4O4 — CID 19933782
2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 19933782) has the molecular formula C42H54Cl2N4O4 and a molecular weight of 749.82 g/mol. Its IUPAC name is 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 19933782 |
| Molecular Formula | C42H54Cl2N4O4 |
| Molecular Weight | 749.82 g/mol |
| Exact Mass | 748.35 |
| IUPAC Name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | OCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1.OCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/2C21H27ClN2O2/c2*22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h2*1-9,21,25H,10-17H2 |
| InChIKey | VHJZPTYRMXBBQD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.82 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|