C20H26ClN3 — CID 174296137
3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propan-1-amine (PubChem CID 174296137) has the molecular formula C20H26ClN3 and a molecular weight of 343.90 g/mol. Its IUPAC name is 3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propan-1-amine.
| Compound Name | 3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 174296137 |
| Molecular Formula | C20H26ClN3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]propan-1-amine |
| SMILES | NCCCN1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H26ClN3/c21-19-9-7-18(8-10-19)20(17-5-2-1-3-6-17)24-15-13-23(14-16-24)12-4-11-22/h1-3,5-10,20H,4,11-16,22H2/t20-/m1/s1 |
| InChIKey | CKFQYALADZBVRI-HXUWFJFHSA-N |
| XLogP | 3.40 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |