C21H28Cl3N3O2 — CID 175673427
2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetamide;dihydrochloride (PubChem CID 175673427) has the molecular formula C21H28Cl3N3O2 and a molecular weight of 460.83 g/mol. Its IUPAC name is 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetamide;dihydrochloride.
| Compound Name | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 175673427 |
| Molecular Formula | C21H28Cl3N3O2 |
| Molecular Weight | 460.83 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[2-[4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)COCCN1CCN([C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H26ClN3O2.2ClH/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)25-12-10-24(11-13-25)14-15-27-16-20(23)26;;/h1-9,21H,10-16H2,(H2,23,26);2*1H/t21-;;/m1../s1 |
| InChIKey | ASDFTQNLTBVBQC-GHVWMZMZSA-N |
| XLogP | 3.39 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|