C26H35Cl2N3O3 — CID 91435889
2-[2-chloroethyl(methyl)amino]ethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate (PubChem CID 91435889) has the molecular formula C26H35Cl2N3O3 and a molecular weight of 508.49 g/mol. Its IUPAC name is 2-[2-chloroethyl(methyl)amino]ethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate.
| Compound Name | 2-[2-chloroethyl(methyl)amino]ethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 91435889 |
| Molecular Formula | C26H35Cl2N3O3 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-[2-chloroethyl(methyl)amino]ethyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
| SMILES | CN(CCCl)CCOC(=O)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H35Cl2N3O3/c1-29(12-11-27)17-20-34-25(32)21-33-19-18-30-13-15-31(16-14-30)26(22-5-3-2-4-6-22)23-7-9-24(28)10-8-23/h2-10,26H,11-21H2,1H3 |
| InChIKey | ZHCHKHAOOLHABW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|