C26H34ClN3O4 — CID 67989743
[4-(methylamino)-4-oxobutan-2-yl] 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate (PubChem CID 67989743) has the molecular formula C26H34ClN3O4 and a molecular weight of 488.03 g/mol. Its IUPAC name is [4-(methylamino)-4-oxobutan-2-yl] 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate.
| Compound Name | [4-(methylamino)-4-oxobutan-2-yl] 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 67989743 |
| Molecular Formula | C26H34ClN3O4 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | [4-(methylamino)-4-oxobutan-2-yl] 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
| SMILES | CNC(=O)CC(C)OC(=O)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H34ClN3O4/c1-20(18-24(31)28-2)34-25(32)19-33-17-16-29-12-14-30(15-13-29)26(21-6-4-3-5-7-21)22-8-10-23(27)11-9-22/h3-11,20,26H,12-19H2,1-2H3,(H,28,31) |
| InChIKey | NTIQEHXNZWUBHW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|