C33H40ClN3O9S — CID 69345053
(2R)-2-(benzenesulfonamido)pentanedioic acid;methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate (PubChem CID 69345053) has the molecular formula C33H40ClN3O9S and a molecular weight of 690.22 g/mol. Its IUPAC name is (2R)-2-(benzenesulfonamido)pentanedioic acid;methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate.
| Compound Name | (2R)-2-(benzenesulfonamido)pentanedioic acid;methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 69345053 |
| Molecular Formula | C33H40ClN3O9S |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 689.22 |
| IUPAC Name | (2R)-2-(benzenesulfonamido)pentanedioic acid;methyl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate |
| SMILES | COC(=O)COCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1.O=C(O)CC[C@@H](NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H27ClN2O3.C11H13NO6S/c1-27-21(26)17-28-16-15-24-11-13-25(14-12-24)22(18-5-3-2-4-6-18)19-7-9-20(23)10-8-19;13-10(14)7-6-9(11(15)16)12-19(17,18)8-4-2-1-3-5-8/h2-10,22H,11-17H2,1H3;1-5,9,12H,6-7H2,(H,13,14)(H,15,16)/t;9-/m.1/s1 |
| InChIKey | ZKYYZTZOEMACJA-YYVQYPFISA-N |
| XLogP | 3.52 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|