C19H26Cl2N2O3 — CID 156599355
4-[[4-(2-hydroxyethyl)piperazin-1-yl]-phenylmethyl]benzene-1,2-diol;dihydrochloride (PubChem CID 156599355) has the molecular formula C19H26Cl2N2O3 and a molecular weight of 401.33 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyethyl)piperazin-1-yl]-phenylmethyl]benzene-1,2-diol;dihydrochloride.
| Compound Name | 4-[[4-(2-hydroxyethyl)piperazin-1-yl]-phenylmethyl]benzene-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 156599355 |
| Molecular Formula | C19H26Cl2N2O3 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-[[4-(2-hydroxyethyl)piperazin-1-yl]-phenylmethyl]benzene-1,2-diol;dihydrochloride |
| SMILES | Cl.Cl.OCCN1CCN(C(c2ccccc2)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C19H24N2O3.2ClH/c22-13-12-20-8-10-21(11-9-20)19(15-4-2-1-3-5-15)16-6-7-17(23)18(24)14-16;;/h1-7,14,19,22-24H,8-13H2;2*1H |
| InChIKey | KYRRIBUOEMLRFW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|