C29H45N3O2 — CID 4102594
2,6-ditert-butyl-4-[[4-(dimethylamino)phenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol (PubChem CID 4102594) has the molecular formula C29H45N3O2 and a molecular weight of 467.70 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[4-(dimethylamino)phenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[4-(dimethylamino)phenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 4102594 |
| Molecular Formula | C29H45N3O2 |
| Molecular Weight | 467.70 g/mol |
| Exact Mass | 467.35 |
| IUPAC Name | 2,6-ditert-butyl-4-[[4-(dimethylamino)phenyl]-[4-(2-hydroxyethyl)piperazin-1-yl]methyl]phenol |
| SMILES | CN(C)c1ccc(C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C29H45N3O2/c1-28(2,3)24-19-22(20-25(27(24)34)29(4,5)6)26(21-9-11-23(12-10-21)30(7)8)32-15-13-31(14-16-32)17-18-33/h9-12,19-20,26,33-34H,13-18H2,1-8H3 |
| InChIKey | ZEFVLIDAULRUJN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|