C26H36ClNO — CID 2129967
2,6-ditert-butyl-4-[(S)-(4-chlorophenyl)-piperidin-1-ylmethyl]phenol (PubChem CID 2129967) has the molecular formula C26H36ClNO and a molecular weight of 414.03 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(S)-(4-chlorophenyl)-piperidin-1-ylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(S)-(4-chlorophenyl)-piperidin-1-ylmethyl]phenol |
|---|---|
| PubChem CID | 2129967 |
| Molecular Formula | C26H36ClNO |
| Molecular Weight | 414.03 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 2,6-ditert-butyl-4-[(S)-(4-chlorophenyl)-piperidin-1-ylmethyl]phenol |
| SMILES | CC(C)(C)c1cc([C@H](c2ccc(Cl)cc2)N2CCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H36ClNO/c1-25(2,3)21-16-19(17-22(24(21)29)26(4,5)6)23(28-14-8-7-9-15-28)18-10-12-20(27)13-11-18/h10-13,16-17,23,29H,7-9,14-15H2,1-6H3/t23-/m0/s1 |
| InChIKey | XBYYHVRHEKKRLT-QHCPKHFHSA-N |
| XLogP | 7.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.03 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |