C33H44FN3O — CID 28720985
2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenol (PubChem CID 28720985) has the molecular formula C33H44FN3O and a molecular weight of 517.73 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 28720985 |
| Molecular Formula | C33H44FN3O |
| Molecular Weight | 517.73 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | 2,6-ditert-butyl-4-[(R)-[4-(dimethylamino)phenyl]-[4-(4-fluorophenyl)piperazin-1-yl]methyl]phenol |
| SMILES | CN(C)c1ccc([C@H](c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H44FN3O/c1-32(2,3)28-21-24(22-29(31(28)38)33(4,5)6)30(23-9-13-26(14-10-23)35(7)8)37-19-17-36(18-20-37)27-15-11-25(34)12-16-27/h9-16,21-22,30,38H,17-20H2,1-8H3/t30-/m1/s1 |
| InChIKey | TYLSPKYIYXNCON-SSEXGKCCSA-N |
| XLogP | 7.10 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.73 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|