C24H32FN7 — CID 3208928
4-[(1-tert-butyltetrazol-5-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline (PubChem CID 3208928) has the molecular formula C24H32FN7 and a molecular weight of 437.57 g/mol. Its IUPAC name is 4-[(1-tert-butyltetrazol-5-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1-tert-butyltetrazol-5-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3208928 |
| Molecular Formula | C24H32FN7 |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 4-[(1-tert-butyltetrazol-5-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2nnnn2C(C)(C)C)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H32FN7/c1-24(2,3)32-23(26-27-28-32)22(18-6-10-20(11-7-18)29(4)5)31-16-14-30(15-17-31)21-12-8-19(25)9-13-21/h6-13,22H,14-17H2,1-5H3 |
| InChIKey | VEHIUTCVAGQHID-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|