C24H31FN6O — CID 3208953
1-[(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-(4-fluorophenyl)piperazine (PubChem CID 3208953) has the molecular formula C24H31FN6O and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 3208953 |
| Molecular Formula | C24H31FN6O |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-(4-fluorophenyl)piperazine |
| SMILES | CCOc1ccc(C(c2nnnn2C(C)(C)C)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H31FN6O/c1-5-32-21-12-6-18(7-13-21)22(23-26-27-28-31(23)24(2,3)4)30-16-14-29(15-17-30)20-10-8-19(25)9-11-20/h6-13,22H,5,14-17H2,1-4H3 |
| InChIKey | PNZNKFPDALSJQZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |