C16H22FN5S — CID 3193511
4-[(1-tert-butyltetrazol-5-yl)-(4-fluorophenyl)methyl]thiomorpholine (PubChem CID 3193511) has the molecular formula C16H22FN5S and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[(1-tert-butyltetrazol-5-yl)-(4-fluorophenyl)methyl]thiomorpholine.
| Compound Name | 4-[(1-tert-butyltetrazol-5-yl)-(4-fluorophenyl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 3193511 |
| Molecular Formula | C16H22FN5S |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-[(1-tert-butyltetrazol-5-yl)-(4-fluorophenyl)methyl]thiomorpholine |
| SMILES | CC(C)(C)n1nnnc1C(c1ccc(F)cc1)N1CCSCC1 |
| InChI | InChI=1S/C16H22FN5S/c1-16(2,3)22-15(18-19-20-22)14(21-8-10-23-11-9-21)12-4-6-13(17)7-5-12/h4-7,14H,8-11H2,1-3H3 |
| InChIKey | LKVHQOXOCIWJSG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |