C18H26FN5O — CID 1432259
1-[(S)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperidin-4-ol (PubChem CID 1432259) has the molecular formula C18H26FN5O and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[(S)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperidin-4-ol.
| Compound Name | 1-[(S)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 1432259 |
| Molecular Formula | C18H26FN5O |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-[(S)-(4-fluorophenyl)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]methyl]piperidin-4-ol |
| SMILES | CCC(C)(C)n1nnnc1[C@@H](c1ccc(F)cc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C18H26FN5O/c1-4-18(2,3)24-17(20-21-22-24)16(13-5-7-14(19)8-6-13)23-11-9-15(25)10-12-23/h5-8,15-16,25H,4,9-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | UWBBIDOJIDBGAJ-MRXNPFEDSA-N |
| XLogP | 2.50 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |