C19H28N6O — CID 1444441
1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidine-4-carboxamide (PubChem CID 1444441) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1444441 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[(S)-[1-(2-methylbutan-2-yl)tetrazol-5-yl]-phenylmethyl]piperidine-4-carboxamide |
| SMILES | CCC(C)(C)n1nnnc1[C@@H](c1ccccc1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H28N6O/c1-4-19(2,3)25-18(21-22-23-25)16(14-8-6-5-7-9-14)24-12-10-15(11-13-24)17(20)26/h5-9,15-16H,4,10-13H2,1-3H3,(H2,20,26)/t16-/m1/s1 |
| InChIKey | JNNVKHUJSOXLLC-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |