C20H28N6O — CID 3208573
1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidine-4-carboxamide (PubChem CID 3208573) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3208573 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-[(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(c2ccccc2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H28N6O/c21-19(27)16-11-13-25(14-12-16)18(15-7-3-1-4-8-15)20-22-23-24-26(20)17-9-5-2-6-10-17/h1,3-4,7-8,16-18H,2,5-6,9-14H2,(H2,21,27) |
| InChIKey | YTHKIKDZTDQGLF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |