C23H28N6O2 — CID 1442957
[4-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 1442957) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is [4-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 1442957 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | [4-[(S)-(1-cyclohexyltetrazol-5-yl)-phenylmethyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN([C@H](c2ccccc2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H28N6O2/c30-23(20-12-7-17-31-20)28-15-13-27(14-16-28)21(18-8-3-1-4-9-18)22-24-25-26-29(22)19-10-5-2-6-11-19/h1,3-4,7-9,12,17,19,21H,2,5-6,10-11,13-16H2/t21-/m1/s1 |
| InChIKey | KRXNDFRJEBEHQJ-OAQYLSRUSA-N |
| XLogP | 3.32 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |