C17H22N6O3S — CID 649176
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 649176) has the molecular formula C17H22N6O3S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 649176 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1nnnn1C1CCCC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H22N6O3S/c24-15(12-27-17-18-19-20-23(17)13-4-1-2-5-13)21-7-9-22(10-8-21)16(25)14-6-3-11-26-14/h3,6,11,13H,1-2,4-5,7-10,12H2 |
| InChIKey | AUWQYGCFJQEDDS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |