C18H26N6 — CID 858129
1-[(S)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperazine (PubChem CID 858129) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 1-[(S)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperazine.
| Compound Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 858129 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-phenylmethyl]-4-methylpiperazine |
| SMILES | CN1CCN([C@H](c2ccccc2)c2nnnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C18H26N6/c1-22-11-13-23(14-12-22)17(15-7-3-2-4-8-15)18-19-20-21-24(18)16-9-5-6-10-16/h2-4,7-8,16-17H,5-6,9-14H2,1H3/t17-/m1/s1 |
| InChIKey | ZBADUWIKAKFHMO-QGZVFWFLSA-N |
| XLogP | 2.12 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |