C21H33N7 — CID 1433911
4-[(R)-(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-N,N-dimethylaniline (PubChem CID 1433911) has the molecular formula C21H33N7 and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-[(R)-(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(R)-(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 1433911 |
| Molecular Formula | C21H33N7 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 4-[(R)-(1-cyclohexyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-N,N-dimethylaniline |
| SMILES | CN1CCN([C@H](c2ccc(N(C)C)cc2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H33N7/c1-25(2)18-11-9-17(10-12-18)20(27-15-13-26(3)14-16-27)21-22-23-24-28(21)19-7-5-4-6-8-19/h9-12,19-20H,4-8,13-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | WNBGORVGSJSSMK-HXUWFJFHSA-N |
| XLogP | 2.58 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|