C21H31N5 — CID 1433524
1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]-4-methylpiperidine (PubChem CID 1433524) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]-4-methylpiperidine.
| Compound Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 1433524 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 1-[(S)-(1-cyclohexyltetrazol-5-yl)-(4-methylphenyl)methyl]-4-methylpiperidine |
| SMILES | Cc1ccc([C@H](c2nnnn2C2CCCCC2)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C21H31N5/c1-16-8-10-18(11-9-16)20(25-14-12-17(2)13-15-25)21-22-23-24-26(21)19-6-4-3-5-7-19/h8-11,17,19-20H,3-7,12-15H2,1-2H3/t20-/m1/s1 |
| InChIKey | NAPMBABMRWFNIG-HXUWFJFHSA-N |
| XLogP | 4.31 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |