C18H24ClN5S — CID 3193514
4-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]thiomorpholine (PubChem CID 3193514) has the molecular formula C18H24ClN5S and a molecular weight of 377.95 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]thiomorpholine.
| Compound Name | 4-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 3193514 |
| Molecular Formula | C18H24ClN5S |
| Molecular Weight | 377.95 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]thiomorpholine |
| SMILES | Clc1ccc(C(c2nnnn2C2CCCCC2)N2CCSCC2)cc1 |
| InChI | InChI=1S/C18H24ClN5S/c19-15-8-6-14(7-9-15)17(23-10-12-25-13-11-23)18-20-21-22-24(18)16-4-2-1-3-5-16/h6-9,16-17H,1-5,10-13H2 |
| InChIKey | KMWZKFGVVKYASK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.95 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |