C24H30ClN7 — CID 3208596
1-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)piperazine (PubChem CID 3208596) has the molecular formula C24H30ClN7 and a molecular weight of 452.01 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)piperazine.
| Compound Name | 1-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 3208596 |
| Molecular Formula | C24H30ClN7 |
| Molecular Weight | 452.01 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[(4-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-4-(pyridin-4-ylmethyl)piperazine |
| SMILES | Clc1ccc(C(c2nnnn2C2CCCCC2)N2CCN(Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C24H30ClN7/c25-21-8-6-20(7-9-21)23(24-27-28-29-32(24)22-4-2-1-3-5-22)31-16-14-30(15-17-31)18-19-10-12-26-13-11-19/h6-13,22-23H,1-5,14-18H2 |
| InChIKey | PGYSVLJDLKNICA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |