C22H31ClN6 — CID 1443494
1-[(S)-(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-cyclopentylpiperazine (PubChem CID 1443494) has the molecular formula C22H31ClN6 and a molecular weight of 414.99 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-cyclopentylpiperazine.
| Compound Name | 1-[(S)-(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-cyclopentylpiperazine |
|---|---|
| PubChem CID | 1443494 |
| Molecular Formula | C22H31ClN6 |
| Molecular Weight | 414.99 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]-4-cyclopentylpiperazine |
| SMILES | Clc1ccc([C@@H](c2nnnn2C2CCCC2)N2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H31ClN6/c23-18-11-9-17(10-12-18)21(22-24-25-26-29(22)20-7-3-4-8-20)28-15-13-27(14-16-28)19-5-1-2-6-19/h9-12,19-21H,1-8,13-16H2/t21-/m0/s1 |
| InChIKey | GWPDQGVMVKKXPX-NRFANRHFSA-N |
| XLogP | 4.09 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.99 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |