C25H31ClN6 — CID 1449106
1-[(R)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-cyclopentylpiperazine (PubChem CID 1449106) has the molecular formula C25H31ClN6 and a molecular weight of 451.02 g/mol. Its IUPAC name is 1-[(R)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-cyclopentylpiperazine.
| Compound Name | 1-[(R)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-cyclopentylpiperazine |
|---|---|
| PubChem CID | 1449106 |
| Molecular Formula | C25H31ClN6 |
| Molecular Weight | 451.02 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-[(R)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-cyclopentylpiperazine |
| SMILES | Clc1ccc([C@H](c2nnnn2CCc2ccccc2)N2CCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H31ClN6/c26-22-12-10-21(11-13-22)24(31-18-16-30(17-19-31)23-8-4-5-9-23)25-27-28-29-32(25)15-14-20-6-2-1-3-7-20/h1-3,6-7,10-13,23-24H,4-5,8-9,14-19H2/t24-/m1/s1 |
| InChIKey | GCGCOHUVSORXEV-XMMPIXPASA-N |
| XLogP | 4.22 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.02 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |